C36H26N2 — CID 172894351
4-[4-[(Z)-1,2-diphenyl-2-(4-pyridin-4-ylphenyl)ethenyl]phenyl]pyridine (PubChem CID 172894351) has the molecular formula C36H26N2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 4-[4-[(Z)-1,2-diphenyl-2-(4-pyridin-4-ylphenyl)ethenyl]phenyl]pyridine.
| Compound Name | 4-[4-[(Z)-1,2-diphenyl-2-(4-pyridin-4-ylphenyl)ethenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 172894351 |
| Molecular Formula | C36H26N2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 4-[4-[(Z)-1,2-diphenyl-2-(4-pyridin-4-ylphenyl)ethenyl]phenyl]pyridine |
| SMILES | c1ccc(/C(=C(\c2ccccc2)c2ccc(-c3ccncc3)cc2)c2ccc(-c3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C36H26N2/c1-3-7-31(8-4-1)35(33-15-11-27(12-16-33)29-19-23-37-24-20-29)36(32-9-5-2-6-10-32)34-17-13-28(14-18-34)30-21-25-38-26-22-30/h1-26H/b36-35- |
| InChIKey | BSFMDMUXORFQHP-KXYMVQBMSA-N |
| XLogP | 8.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|