C31H28BNO3 — CID 158859997
boric acid;pyridine;1,2,2-triphenylethenylbenzene (PubChem CID 158859997) has the molecular formula C31H28BNO3 and a molecular weight of 473.38 g/mol. Its IUPAC name is boric acid;pyridine;1,2,2-triphenylethenylbenzene.
| Compound Name | boric acid;pyridine;1,2,2-triphenylethenylbenzene |
|---|---|
| PubChem CID | 158859997 |
| Molecular Formula | C31H28BNO3 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | boric acid;pyridine;1,2,2-triphenylethenylbenzene |
| SMILES | OB(O)O.c1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1.c1ccncc1 |
| InChI | InChI=1S/C26H20.C5H5N.BH3O3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)26(23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-4-6-5-3-1;2-1(3)4/h1-20H;1-5H;2-4H |
| InChIKey | JANOCKPGSDDKIF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|