About phenylboronic acid;pyridine
phenylboronic acid;pyridine (PubChem CID 160947714) has the molecular formula C11H12BNO2
and a molecular weight of 201.03 g/mol. Its IUPAC name is phenylboronic acid;pyridine.
Molecular Properties
| Compound Name | phenylboronic acid;pyridine |
| PubChem CID | 160947714 |
| Molecular Formula | C11H12BNO2 |
| Molecular Weight | 201.03 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | phenylboronic acid;pyridine |
| SMILES | OB(O)c1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C6H7BO2.C5H5N/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,8-9H;1-5H |
| InChIKey | SVIJSYMCHSVVIS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.03 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylboronic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylboronic acid;pyridine?
The IUPAC name of phenylboronic acid;pyridine (CID 160947714) is phenylboronic acid;pyridine.
What is the SMILES notation for phenylboronic acid;pyridine?
The canonical SMILES for phenylboronic acid;pyridine is OB(O)c1ccccc1.c1ccncc1.
What is the InChIKey of phenylboronic acid;pyridine?
The InChIKey is SVIJSYMCHSVVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BO2.C5H5N/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,8-9H;1-5H.
What are the key properties of phenylboronic acid;pyridine?
phenylboronic acid;pyridine has a molecular weight of 201.03 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenylboronic acid;pyridine is sourced from PubChem (CID 160947714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).