About phenylboronic acid;propan-2-one
phenylboronic acid;propan-2-one (PubChem CID 175374589) has the molecular formula C9H13BO3
and a molecular weight of 180.01 g/mol. Its IUPAC name is phenylboronic acid;propan-2-one.
Molecular Properties
| Compound Name | phenylboronic acid;propan-2-one |
| PubChem CID | 175374589 |
| Molecular Formula | C9H13BO3 |
| Molecular Weight | 180.01 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | phenylboronic acid;propan-2-one |
| SMILES | CC(C)=O.OB(O)c1ccccc1 |
| InChI | InChI=1S/C6H7BO2.C3H6O/c8-7(9)6-4-2-1-3-5-6;1-3(2)4/h1-5,8-9H;1-2H3 |
| InChIKey | XIIGPHQIZSWYOM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.01 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylboronic acid;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylboronic acid;propan-2-one?
The IUPAC name of phenylboronic acid;propan-2-one (CID 175374589) is phenylboronic acid;propan-2-one.
What is the SMILES notation for phenylboronic acid;propan-2-one?
The canonical SMILES for phenylboronic acid;propan-2-one is CC(C)=O.OB(O)c1ccccc1.
What is the InChIKey of phenylboronic acid;propan-2-one?
The InChIKey is XIIGPHQIZSWYOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BO2.C3H6O/c8-7(9)6-4-2-1-3-5-6;1-3(2)4/h1-5,8-9H;1-2H3.
What are the key properties of phenylboronic acid;propan-2-one?
phenylboronic acid;propan-2-one has a molecular weight of 180.01 g/mol, XLogP of -0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenylboronic acid;propan-2-one is sourced from PubChem (CID 175374589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).