C29H29BO4 — CID 165094537
1-(4-methylphenyl)ethanone;phenylboronic acid;1-(4-phenylphenyl)ethanone (PubChem CID 165094537) has the molecular formula C29H29BO4 and a molecular weight of 452.36 g/mol. Its IUPAC name is 1-(4-methylphenyl)ethanone;phenylboronic acid;1-(4-phenylphenyl)ethanone.
| Compound Name | 1-(4-methylphenyl)ethanone;phenylboronic acid;1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 165094537 |
| Molecular Formula | C29H29BO4 |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-(4-methylphenyl)ethanone;phenylboronic acid;1-(4-phenylphenyl)ethanone |
| SMILES | CC(=O)c1ccc(-c2ccccc2)cc1.CC(=O)c1ccc(C)cc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O.C9H10O.C6H7BO2/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;1-7-3-5-9(6-4-7)8(2)10;8-7(9)6-4-2-1-3-5-6/h2-10H,1H3;3-6H,1-2H3;1-5,8-9H |
| InChIKey | XGPVZJKDIUHZLG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|