C53H37N3 — CID 138548269
2,4-diphenyl-6-[4-[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 138548269) has the molecular formula C53H37N3 and a molecular weight of 715.90 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 138548269 |
| Molecular Formula | C53H37N3 |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | 2,4-diphenyl-6-[4-[4-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(C(=C(c2ccccc2)c2ccc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C53H37N3/c1-6-16-42(17-7-1)49(43-18-8-2-9-19-43)50(44-20-10-3-11-21-44)45-34-30-40(31-35-45)38-26-28-39(29-27-38)41-32-36-48(37-33-41)53-55-51(46-22-12-4-13-23-46)54-52(56-53)47-24-14-5-15-25-47/h1-37H |
| InChIKey | ROBKWLAPLSJNMO-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|