C54H36N4 — CID 138548266
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]benzonitrile (PubChem CID 138548266) has the molecular formula C54H36N4 and a molecular weight of 740.91 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 138548266 |
| Molecular Formula | C54H36N4 |
| Molecular Weight | 740.91 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(1,2,2-triphenylethenyl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C54H36N4/c55-37-38-17-16-28-46(33-38)48-34-47(35-49(36-48)54-57-52(44-24-12-4-13-25-44)56-53(58-54)45-26-14-5-15-27-45)39-29-31-43(32-30-39)51(42-22-10-3-11-23-42)50(40-18-6-1-7-19-40)41-20-8-2-9-21-41/h1-36H |
| InChIKey | QSXTXVFIFOVOHK-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.91 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|