C49H31N7 — CID 176848065
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile (PubChem CID 176848065) has the molecular formula C49H31N7 and a molecular weight of 717.84 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 176848065 |
| Molecular Formula | C49H31N7 |
| Molecular Weight | 717.84 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C49H31N7/c50-32-33-15-13-24-38(27-33)41-29-42(31-43(30-41)49-55-46(36-20-9-3-10-21-36)52-47(56-49)37-22-11-4-12-23-37)39-25-14-26-40(28-39)48-53-44(34-16-5-1-6-17-34)51-45(54-48)35-18-7-2-8-19-35/h1-31H |
| InChIKey | KEAALSAEXQBFRP-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 101.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.84 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |