C20H14N2 — CID 6145439
(E)-2,3-diphenyl-3-pyridin-3-ylprop-2-enenitrile (PubChem CID 6145439) has the molecular formula C20H14N2 and a molecular weight of 282.35 g/mol. Its IUPAC name is (E)-2,3-diphenyl-3-pyridin-3-ylprop-2-enenitrile.
| Compound Name | (E)-2,3-diphenyl-3-pyridin-3-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 6145439 |
| Molecular Formula | C20H14N2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (E)-2,3-diphenyl-3-pyridin-3-ylprop-2-enenitrile |
| SMILES | N#C/C(=C(\c1ccccc1)c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C20H14N2/c21-14-19(16-8-3-1-4-9-16)20(17-10-5-2-6-11-17)18-12-7-13-22-15-18/h1-13,15H/b20-19- |
| InChIKey | NGZJFSVVKFORBJ-VXPUYCOJSA-N |
| XLogP | 4.56 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|