C15H10ClN — CID 21395317
(Z)-3-chloro-2,3-diphenylprop-2-enenitrile (PubChem CID 21395317) has the molecular formula C15H10ClN and a molecular weight of 239.71 g/mol. Its IUPAC name is (Z)-3-chloro-2,3-diphenylprop-2-enenitrile.
| Compound Name | (Z)-3-chloro-2,3-diphenylprop-2-enenitrile |
|---|---|
| PubChem CID | 21395317 |
| Molecular Formula | C15H10ClN |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (Z)-3-chloro-2,3-diphenylprop-2-enenitrile |
| SMILES | N#C/C(=C(\Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H10ClN/c16-15(13-9-5-2-6-10-13)14(11-17)12-7-3-1-4-8-12/h1-10H/b15-14+ |
| InChIKey | YBCUGNOELMYKKL-CCEZHUSRSA-N |
| XLogP | 4.32 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|