C17H14ClN — CID 76922556
3-chloro-3-(2,5-dimethylphenyl)-2-phenylprop-2-enenitrile (PubChem CID 76922556) has the molecular formula C17H14ClN and a molecular weight of 267.76 g/mol. Its IUPAC name is 3-chloro-3-(2,5-dimethylphenyl)-2-phenylprop-2-enenitrile.
| Compound Name | 3-chloro-3-(2,5-dimethylphenyl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 76922556 |
| Molecular Formula | C17H14ClN |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-chloro-3-(2,5-dimethylphenyl)-2-phenylprop-2-enenitrile |
| SMILES | Cc1ccc(C)c(C(Cl)=C(C#N)c2ccccc2)c1 |
| InChI | InChI=1S/C17H14ClN/c1-12-8-9-13(2)15(10-12)17(18)16(11-19)14-6-4-3-5-7-14/h3-10H,1-2H3 |
| InChIKey | QMCFUIUMXBLOQK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|