C26H20N4O3 — CID 23509211
2-[4-(N-[4-(2,3-dihydroxypropoxy)phenyl]anilino)phenyl]ethene-1,1,2-tricarbonitrile (PubChem CID 23509211) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-[4-(N-[4-(2,3-dihydroxypropoxy)phenyl]anilino)phenyl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(N-[4-(2,3-dihydroxypropoxy)phenyl]anilino)phenyl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 23509211 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-[4-(N-[4-(2,3-dihydroxypropoxy)phenyl]anilino)phenyl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(N(c2ccccc2)c2ccc(OCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C26H20N4O3/c27-14-20(15-28)26(16-29)19-6-8-22(9-7-19)30(21-4-2-1-3-5-21)23-10-12-25(13-11-23)33-18-24(32)17-31/h1-13,24,31-32H,17-18H2 |
| InChIKey | RWGRZHIPTNJCKT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|