C43H30N4O6 — CID 102217370
2-[4-[bis[2-[4-(2-oxo-2-phenylacetyl)phenoxy]ethyl]amino]phenyl]ethene-1,1,2-tricarbonitrile (PubChem CID 102217370) has the molecular formula C43H30N4O6 and a molecular weight of 698.74 g/mol. Its IUPAC name is 2-[4-[bis[2-[4-(2-oxo-2-phenylacetyl)phenoxy]ethyl]amino]phenyl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-[bis[2-[4-(2-oxo-2-phenylacetyl)phenoxy]ethyl]amino]phenyl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 102217370 |
| Molecular Formula | C43H30N4O6 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 2-[4-[bis[2-[4-(2-oxo-2-phenylacetyl)phenoxy]ethyl]amino]phenyl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(N(CCOc2ccc(C(=O)C(=O)c3ccccc3)cc2)CCOc2ccc(C(=O)C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H30N4O6/c44-27-35(28-45)39(29-46)30-11-17-36(18-12-30)47(23-25-52-37-19-13-33(14-20-37)42(50)40(48)31-7-3-1-4-8-31)24-26-53-38-21-15-34(16-22-38)43(51)41(49)32-9-5-2-6-10-32/h1-22H,23-26H2 |
| InChIKey | FLPOKJHBXFLRIL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 161.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|