C35H31NO3 — CID 59739338
3-[4-[1-phenyl-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol (PubChem CID 59739338) has the molecular formula C35H31NO3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-[4-[1-phenyl-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[1-phenyl-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59739338 |
| Molecular Formula | C35H31NO3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[4-[1-phenyl-2-[4-(N-phenylanilino)phenyl]ethenyl]phenoxy]propane-1,2-diol |
| SMILES | OCC(O)COc1ccc(C(=Cc2ccc(N(c3ccccc3)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H31NO3/c37-25-33(38)26-39-34-22-18-29(19-23-34)35(28-10-4-1-5-11-28)24-27-16-20-32(21-17-27)36(30-12-6-2-7-13-30)31-14-8-3-9-15-31/h1-24,33,37-38H,25-26H2 |
| InChIKey | WUBRPBFVHVNIGX-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|