C31H31NO3 — CID 23132622
3-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]propane-1,2-diol (PubChem CID 23132622) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 23132622 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 3-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenoxy]propane-1,2-diol |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(/C=C/c3ccc(OCC(O)CO)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H31NO3/c1-23-3-13-27(14-4-23)32(28-15-5-24(2)6-16-28)29-17-9-25(10-18-29)7-8-26-11-19-31(20-12-26)35-22-30(34)21-33/h3-20,30,33-34H,21-22H2,1-2H3/b8-7+ |
| InChIKey | DXIUMUODJZNVPS-BQYQJAHWSA-N |
| XLogP | 6.68 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|