C38H45NO9 — CID 89268743
2-ethoxy-1-[4-[2-[4-[4-(2-ethoxy-1-hydroxyethoxy)-N-[4-(2-ethoxy-1-hydroxyethoxy)phenyl]anilino]phenyl]ethenyl]phenoxy]ethanol (PubChem CID 89268743) has the molecular formula C38H45NO9 and a molecular weight of 659.78 g/mol. Its IUPAC name is 2-ethoxy-1-[4-[2-[4-[4-(2-ethoxy-1-hydroxyethoxy)-N-[4-(2-ethoxy-1-hydroxyethoxy)phenyl]anilino]phenyl]ethenyl]phenoxy]ethanol.
| Compound Name | 2-ethoxy-1-[4-[2-[4-[4-(2-ethoxy-1-hydroxyethoxy)-N-[4-(2-ethoxy-1-hydroxyethoxy)phenyl]anilino]phenyl]ethenyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 89268743 |
| Molecular Formula | C38H45NO9 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | 2-ethoxy-1-[4-[2-[4-[4-(2-ethoxy-1-hydroxyethoxy)-N-[4-(2-ethoxy-1-hydroxyethoxy)phenyl]anilino]phenyl]ethenyl]phenoxy]ethanol |
| SMILES | CCOCC(O)Oc1ccc(C=Cc2ccc(N(c3ccc(OC(O)COCC)cc3)c3ccc(OC(O)COCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H45NO9/c1-4-43-25-36(40)46-33-19-11-29(12-20-33)8-7-28-9-13-30(14-10-28)39(31-15-21-34(22-16-31)47-37(41)26-44-5-2)32-17-23-35(24-18-32)48-38(42)27-45-6-3/h7-24,36-38,40-42H,4-6,25-27H2,1-3H3 |
| InChIKey | LGNPROCHHKOVAE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|