C19H22FNO2 — CID 59547143
2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenoxy]-3-fluoropropan-1-ol (PubChem CID 59547143) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenoxy]-3-fluoropropan-1-ol.
| Compound Name | 2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenoxy]-3-fluoropropan-1-ol |
|---|---|
| PubChem CID | 59547143 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenoxy]-3-fluoropropan-1-ol |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(OC(CO)CF)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO2/c1-21(2)17-9-5-15(6-10-17)3-4-16-7-11-18(12-8-16)23-19(13-20)14-22/h3-12,19,22H,13-14H2,1-2H3/b4-3+ |
| InChIKey | PKANTIVYKGEMMK-ONEGZZNKSA-N |
| XLogP | 3.63 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|