C17H19NO3 — CID 59547147
2-[4-[(E)-2-(4-aminophenyl)ethenyl]phenoxy]propane-1,3-diol (PubChem CID 59547147) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-aminophenyl)ethenyl]phenoxy]propane-1,3-diol.
| Compound Name | 2-[4-[(E)-2-(4-aminophenyl)ethenyl]phenoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 59547147 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[4-[(E)-2-(4-aminophenyl)ethenyl]phenoxy]propane-1,3-diol |
| SMILES | Nc1ccc(/C=C/c2ccc(OC(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C17H19NO3/c18-15-7-3-13(4-8-15)1-2-14-5-9-16(10-6-14)21-17(11-19)12-20/h1-10,17,19-20H,11-12,18H2/b2-1+ |
| InChIKey | WVMIQWBAJVGGME-OWOJBTEDSA-N |
| XLogP | 2.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|