C16H16N2O3S — CID 59547157
2-[[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]oxy]propane-1,3-diol (PubChem CID 59547157) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]oxy]propane-1,3-diol.
| Compound Name | 2-[[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]oxy]propane-1,3-diol |
|---|---|
| PubChem CID | 59547157 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-[[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]oxy]propane-1,3-diol |
| SMILES | Nc1ccc(-c2nc3ccc(OC(CO)CO)cc3s2)cc1 |
| InChI | InChI=1S/C16H16N2O3S/c17-11-3-1-10(2-4-11)16-18-14-6-5-12(7-15(14)22-16)21-13(8-19)9-20/h1-7,13,19-20H,8-9,17H2 |
| InChIKey | PQOCLKODUHLXPP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|