C35H31NO3 — CID 146521934
[4-[(Z)-2-[4-[4-(hydroxymethyl)-N-[4-(hydroxymethyl)phenyl]anilino]phenyl]-1-phenylethenyl]phenyl]methanol (PubChem CID 146521934) has the molecular formula C35H31NO3 and a molecular weight of 513.64 g/mol. Its IUPAC name is [4-[(Z)-2-[4-[4-(hydroxymethyl)-N-[4-(hydroxymethyl)phenyl]anilino]phenyl]-1-phenylethenyl]phenyl]methanol.
| Compound Name | [4-[(Z)-2-[4-[4-(hydroxymethyl)-N-[4-(hydroxymethyl)phenyl]anilino]phenyl]-1-phenylethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 146521934 |
| Molecular Formula | C35H31NO3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | [4-[(Z)-2-[4-[4-(hydroxymethyl)-N-[4-(hydroxymethyl)phenyl]anilino]phenyl]-1-phenylethenyl]phenyl]methanol |
| SMILES | OCc1ccc(/C(=C\c2ccc(N(c3ccc(CO)cc3)c3ccc(CO)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H31NO3/c37-23-27-6-14-31(15-7-27)35(30-4-2-1-3-5-30)22-26-8-16-32(17-9-26)36(33-18-10-28(24-38)11-19-33)34-20-12-29(25-39)13-21-34/h1-22,37-39H,23-25H2/b35-22- |
| InChIKey | CEWJPRCBPAQYCJ-QHDYCIAZSA-N |
| XLogP | 7.22 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|