C48H48N2 — CID 59935150
4-[(Z)-2-[4-[4-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline (PubChem CID 59935150) has the molecular formula C48H48N2 and a molecular weight of 652.93 g/mol. Its IUPAC name is 4-[(Z)-2-[4-[4-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(Z)-2-[4-[4-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 59935150 |
| Molecular Formula | C48H48N2 |
| Molecular Weight | 652.93 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | 4-[(Z)-2-[4-[4-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C(=C\c2ccc(-c3ccc(/C=C(\c4ccccc4)c4ccc(N(CC)CC)cc4)cc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H48N2/c1-5-49(6-2)45-31-27-43(28-32-45)47(41-15-11-9-12-16-41)35-37-19-23-39(24-20-37)40-25-21-38(22-26-40)36-48(42-17-13-10-14-18-42)44-29-33-46(34-30-44)50(7-3)8-4/h9-36H,5-8H2,1-4H3/b47-35-,48-36+ |
| InChIKey | ADUCUQZMIFVVHZ-ULWUYRPPSA-N |
| XLogP | 12.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.93 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|