C42H44N2 — CID 59935157
4-[(Z)-2-[3-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline (PubChem CID 59935157) has the molecular formula C42H44N2 and a molecular weight of 576.83 g/mol. Its IUPAC name is 4-[(Z)-2-[3-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(Z)-2-[3-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 59935157 |
| Molecular Formula | C42H44N2 |
| Molecular Weight | 576.83 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 4-[(Z)-2-[3-[(E)-2-[4-(diethylamino)phenyl]-2-phenylethenyl]phenyl]-1-phenylethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C(=C\c2cccc(/C=C(\c3ccccc3)c3ccc(N(CC)CC)cc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H44N2/c1-5-43(6-2)39-26-22-37(23-27-39)41(35-18-11-9-12-19-35)31-33-16-15-17-34(30-33)32-42(36-20-13-10-14-21-36)38-24-28-40(29-25-38)44(7-3)8-4/h9-32H,5-8H2,1-4H3/b41-31-,42-32+ |
| InChIKey | JMPMCJGYPNTKFX-XIZUVVSZSA-N |
| XLogP | 10.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.83 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|