C36H40N2 — CID 141404078
4-[1-[4-(diethylamino)phenyl]-2-(4-ethenylphenyl)-2-phenylethenyl]-N,N-diethylaniline (PubChem CID 141404078) has the molecular formula C36H40N2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 4-[1-[4-(diethylamino)phenyl]-2-(4-ethenylphenyl)-2-phenylethenyl]-N,N-diethylaniline.
| Compound Name | 4-[1-[4-(diethylamino)phenyl]-2-(4-ethenylphenyl)-2-phenylethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 141404078 |
| Molecular Formula | C36H40N2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 4-[1-[4-(diethylamino)phenyl]-2-(4-ethenylphenyl)-2-phenylethenyl]-N,N-diethylaniline |
| SMILES | C=Cc1ccc(C(=C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H40N2/c1-6-28-16-18-30(19-17-28)35(29-14-12-11-13-15-29)36(31-20-24-33(25-21-31)37(7-2)8-3)32-22-26-34(27-23-32)38(9-4)10-5/h6,11-27H,1,7-10H2,2-5H3 |
| InChIKey | GTDSPYDPFGDZGA-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|