C31H30N2O — CID 102222128
4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]benzaldehyde (PubChem CID 102222128) has the molecular formula C31H30N2O and a molecular weight of 446.59 g/mol. Its IUPAC name is 4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]benzaldehyde.
| Compound Name | 4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]benzaldehyde |
|---|---|
| PubChem CID | 102222128 |
| Molecular Formula | C31H30N2O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]benzaldehyde |
| SMILES | CN(C)c1ccc(C(=C(c2ccccc2)c2ccc(C=O)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O/c1-32(2)28-18-14-26(15-19-28)31(27-16-20-29(21-17-27)33(3)4)30(24-8-6-5-7-9-24)25-12-10-23(22-34)11-13-25/h5-22H,1-4H3 |
| InChIKey | LMIVXAJFXGFRRW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|