C34H30N4 — CID 118474785
2-[[4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]phenyl]methylidene]propanedinitrile (PubChem CID 118474785) has the molecular formula C34H30N4 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[[4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 118474785 |
| Molecular Formula | C34H30N4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-[[4-[2,2-bis[4-(dimethylamino)phenyl]-1-phenylethenyl]phenyl]methylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(C(=C(c2ccccc2)c2ccc(C=C(C#N)C#N)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H30N4/c1-37(2)31-18-14-29(15-19-31)34(30-16-20-32(21-17-30)38(3)4)33(27-8-6-5-7-9-27)28-12-10-25(11-13-28)22-26(23-35)24-36/h5-22H,1-4H3 |
| InChIKey | HJJDMJMBHJAUQD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|