C22H20FN — CID 101071138
4-[(E)-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline (PubChem CID 101071138) has the molecular formula C22H20FN and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-[(E)-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101071138 |
| Molecular Formula | C22H20FN |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[(E)-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C(=C/c2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20FN/c1-24(2)21-14-10-19(11-15-21)22(18-6-4-3-5-7-18)16-17-8-12-20(23)13-9-17/h3-16H,1-2H3/b22-16+ |
| InChIKey | ZMSAIBYJYZQTHN-CJLVFECKSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|