C22H19BrFN — CID 101070753
4-[(Z)-2-bromo-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline (PubChem CID 101070753) has the molecular formula C22H19BrFN and a molecular weight of 396.30 g/mol. Its IUPAC name is 4-[(Z)-2-bromo-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-2-bromo-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101070753 |
| Molecular Formula | C22H19BrFN |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-[(Z)-2-bromo-2-(4-fluorophenyl)-1-phenylethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C(=C(\Br)c2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19BrFN/c1-25(2)20-14-10-17(11-15-20)21(16-6-4-3-5-7-16)22(23)18-8-12-19(24)13-9-18/h3-15H,1-2H3/b22-21- |
| InChIKey | NGKZNXILCKLRPH-DQRAZIAOSA-N |
| XLogP | 6.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|