C22H19Br — CID 3032769
1-[(E)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene (PubChem CID 3032769) has the molecular formula C22H19Br and a molecular weight of 363.30 g/mol. Its IUPAC name is 1-[(E)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene.
| Compound Name | 1-[(E)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene |
|---|---|
| PubChem CID | 3032769 |
| Molecular Formula | C22H19Br |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-[(E)-2-bromo-1,2-diphenylethenyl]-4-ethylbenzene |
| SMILES | CCc1ccc(/C(=C(/Br)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19Br/c1-2-17-13-15-19(16-14-17)21(18-9-5-3-6-10-18)22(23)20-11-7-4-8-12-20/h3-16H,2H2,1H3/b22-21+ |
| InChIKey | OQCYTSHIQNPJIC-QURGRASLSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|