C20H14BrCl — CID 6509575
1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-chlorobenzene (PubChem CID 6509575) has the molecular formula C20H14BrCl and a molecular weight of 369.69 g/mol. Its IUPAC name is 1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-chlorobenzene.
| Compound Name | 1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-chlorobenzene |
|---|---|
| PubChem CID | 6509575 |
| Molecular Formula | C20H14BrCl |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 1-[(Z)-2-bromo-1,2-diphenylethenyl]-4-chlorobenzene |
| SMILES | Clc1ccc(/C(=C(\Br)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14BrCl/c21-20(17-9-5-2-6-10-17)19(15-7-3-1-4-8-15)16-11-13-18(22)14-12-16/h1-14H/b20-19- |
| InChIKey | RKOAUGLLPKMQQD-VXPUYCOJSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|