C19H14ClN — CID 2803926
1-(4-chlorophenyl)-N,1-diphenylmethanimine (PubChem CID 2803926) has the molecular formula C19H14ClN and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,1-diphenylmethanimine.
| Compound Name | 1-(4-chlorophenyl)-N,1-diphenylmethanimine |
|---|---|
| PubChem CID | 2803926 |
| Molecular Formula | C19H14ClN |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N,1-diphenylmethanimine |
| SMILES | Clc1ccc(/C(=N/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14ClN/c20-17-13-11-16(12-14-17)19(15-7-3-1-4-8-15)21-18-9-5-2-6-10-18/h1-14H/b21-19+ |
| InChIKey | QJZVGCIIYYWULP-XUTLUUPISA-N |
| XLogP | 5.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|