C21H13F6N — CID 2317227
N-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine (PubChem CID 2317227) has the molecular formula C21H13F6N and a molecular weight of 393.33 g/mol. Its IUPAC name is N-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine.
| Compound Name | N-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 2317227 |
| Molecular Formula | C21H13F6N |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]methanimine |
| SMILES | FC(F)(F)c1ccc(C(=Nc2ccccc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H13F6N/c22-20(23,24)16-10-6-14(7-11-16)19(28-18-4-2-1-3-5-18)15-8-12-17(13-9-15)21(25,26)27/h1-13H |
| InChIKey | AMSPEPRIBOWIRU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|