C33H25ClO — CID 6380826
(E)-3-(4-chlorophenyl)-1,1,2,3-tetraphenylprop-2-en-1-ol (PubChem CID 6380826) has the molecular formula C33H25ClO and a molecular weight of 473.02 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1,1,2,3-tetraphenylprop-2-en-1-ol.
| Compound Name | (E)-3-(4-chlorophenyl)-1,1,2,3-tetraphenylprop-2-en-1-ol |
|---|---|
| PubChem CID | 6380826 |
| Molecular Formula | C33H25ClO |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1,1,2,3-tetraphenylprop-2-en-1-ol |
| SMILES | OC(/C(=C(\c1ccccc1)c1ccc(Cl)cc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H25ClO/c34-30-23-21-26(22-24-30)31(25-13-5-1-6-14-25)32(27-15-7-2-8-16-27)33(35,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-24,35H/b32-31+ |
| InChIKey | CXWQHWSAZDMFGY-QNEJGDQOSA-N |
| XLogP | 8.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|