C30H23ClO — CID 101410015
(Z)-6-(4-chlorophenyl)-2,3,4-triphenylhex-3-en-5-yn-2-ol (PubChem CID 101410015) has the molecular formula C30H23ClO and a molecular weight of 434.97 g/mol. Its IUPAC name is (Z)-6-(4-chlorophenyl)-2,3,4-triphenylhex-3-en-5-yn-2-ol.
| Compound Name | (Z)-6-(4-chlorophenyl)-2,3,4-triphenylhex-3-en-5-yn-2-ol |
|---|---|
| PubChem CID | 101410015 |
| Molecular Formula | C30H23ClO |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (Z)-6-(4-chlorophenyl)-2,3,4-triphenylhex-3-en-5-yn-2-ol |
| SMILES | CC(O)(/C(=C(\C#Cc1ccc(Cl)cc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H23ClO/c1-30(32,26-15-9-4-10-16-26)29(25-13-7-3-8-14-25)28(24-11-5-2-6-12-24)22-19-23-17-20-27(31)21-18-23/h2-18,20-21,32H,1H3/b29-28+ |
| InChIKey | ZUPQZDRGLILXCW-ZQHSETAFSA-N |
| XLogP | 7.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|