About cesium;4-chlorobenzoic acid;fluoride
cesium;4-chlorobenzoic acid;fluoride (PubChem CID 175696882) has the molecular formula C7H5ClCsFO2
and a molecular weight of 308.47 g/mol. Its IUPAC name is cesium;4-chlorobenzoic acid;fluoride.
Molecular Properties
| Compound Name | cesium;4-chlorobenzoic acid;fluoride |
| PubChem CID | 175696882 |
| Molecular Formula | C7H5ClCsFO2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | cesium;4-chlorobenzoic acid;fluoride |
| SMILES | O=C(O)c1ccc(Cl)cc1.[Cs+].[F-] |
| InChI | InChI=1S/C7H5ClO2.Cs.FH/c8-6-3-1-5(2-4-6)7(9)10;;/h1-4H,(H,9,10);;1H/q;+1;/p-1 |
| InChIKey | YHKJYDKFLVTJJI-UHFFFAOYSA-M |
| XLogP | -3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cesium;4-chlorobenzoic acid;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;4-chlorobenzoic acid;fluoride?
The IUPAC name of cesium;4-chlorobenzoic acid;fluoride (CID 175696882) is cesium;4-chlorobenzoic acid;fluoride.
What is the SMILES notation for cesium;4-chlorobenzoic acid;fluoride?
The canonical SMILES for cesium;4-chlorobenzoic acid;fluoride is O=C(O)c1ccc(Cl)cc1.[Cs+].[F-].
What is the InChIKey of cesium;4-chlorobenzoic acid;fluoride?
The InChIKey is YHKJYDKFLVTJJI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5ClO2.Cs.FH/c8-6-3-1-5(2-4-6)7(9)10;;/h1-4H,(H,9,10);;1H/q;+1;/p-1.
What are the key properties of cesium;4-chlorobenzoic acid;fluoride?
cesium;4-chlorobenzoic acid;fluoride has a molecular weight of 308.47 g/mol, XLogP of -3.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;4-chlorobenzoic acid;fluoride is sourced from PubChem (CID 175696882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).