About 4-chlorobenzoic acid;molecular hydrogen
4-chlorobenzoic acid;molecular hydrogen (PubChem CID 175545154) has the molecular formula C7H7ClO2
and a molecular weight of 158.58 g/mol. Its IUPAC name is 4-chlorobenzoic acid;molecular hydrogen.
Molecular Properties
| Compound Name | 4-chlorobenzoic acid;molecular hydrogen |
| PubChem CID | 175545154 |
| Molecular Formula | C7H7ClO2 |
| Molecular Weight | 158.58 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 4-chlorobenzoic acid;molecular hydrogen |
| SMILES | O=C(O)c1ccc(Cl)cc1.[H][H] |
| InChI | InChI=1S/C7H5ClO2.H2/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H |
| InChIKey | UHJDHQOBQSXXMQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chlorobenzoic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzoic acid;molecular hydrogen?
The IUPAC name of 4-chlorobenzoic acid;molecular hydrogen (CID 175545154) is 4-chlorobenzoic acid;molecular hydrogen.
What is the SMILES notation for 4-chlorobenzoic acid;molecular hydrogen?
The canonical SMILES for 4-chlorobenzoic acid;molecular hydrogen is O=C(O)c1ccc(Cl)cc1.[H][H].
What is the InChIKey of 4-chlorobenzoic acid;molecular hydrogen?
The InChIKey is UHJDHQOBQSXXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2.H2/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,(H,9,10);1H.
What are the key properties of 4-chlorobenzoic acid;molecular hydrogen?
4-chlorobenzoic acid;molecular hydrogen has a molecular weight of 158.58 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzoic acid;molecular hydrogen is sourced from PubChem (CID 175545154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).