C22H16Cl2F2O — CID 156695080
3,3-bis(4-chlorophenyl)-2,2-difluoro-1-phenylbutan-1-one (PubChem CID 156695080) has the molecular formula C22H16Cl2F2O and a molecular weight of 405.27 g/mol. Its IUPAC name is 3,3-bis(4-chlorophenyl)-2,2-difluoro-1-phenylbutan-1-one.
| Compound Name | 3,3-bis(4-chlorophenyl)-2,2-difluoro-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 156695080 |
| Molecular Formula | C22H16Cl2F2O |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 3,3-bis(4-chlorophenyl)-2,2-difluoro-1-phenylbutan-1-one |
| SMILES | CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(F)(F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16Cl2F2O/c1-21(16-7-11-18(23)12-8-16,17-9-13-19(24)14-10-17)22(25,26)20(27)15-5-3-2-4-6-15/h2-14H,1H3 |
| InChIKey | SIGVJIHHIFVNJN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |