C28H20Cl2O2 — CID 167435249
2,2-bis(4-chlorophenyl)-1,4-diphenylbutane-1,4-dione (PubChem CID 167435249) has the molecular formula C28H20Cl2O2 and a molecular weight of 459.37 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2,2-bis(4-chlorophenyl)-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 167435249 |
| Molecular Formula | C28H20Cl2O2 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-1,4-diphenylbutane-1,4-dione |
| SMILES | O=C(CC(C(=O)c1ccccc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H20Cl2O2/c29-24-15-11-22(12-16-24)28(23-13-17-25(30)18-14-23,27(32)21-9-5-2-6-10-21)19-26(31)20-7-3-1-4-8-20/h1-18H,19H2 |
| InChIKey | FIWOSQHLUSAOAS-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |