C20H14Cl2OS — CID 18982559
2,2-bis(4-chlorophenyl)-1-phenyl-2-sulfanylethanone (PubChem CID 18982559) has the molecular formula C20H14Cl2OS and a molecular weight of 373.30 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-1-phenyl-2-sulfanylethanone.
| Compound Name | 2,2-bis(4-chlorophenyl)-1-phenyl-2-sulfanylethanone |
|---|---|
| PubChem CID | 18982559 |
| Molecular Formula | C20H14Cl2OS |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-1-phenyl-2-sulfanylethanone |
| SMILES | O=C(c1ccccc1)C(S)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl2OS/c21-17-10-6-15(7-11-17)20(24,16-8-12-18(22)13-9-16)19(23)14-4-2-1-3-5-14/h1-13,24H |
| InChIKey | RNUOJKSNNZDXGJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|