C30H26O2 — CID 167435265
2-(4-ethylphenyl)-1,2,4-triphenylbutane-1,4-dione (PubChem CID 167435265) has the molecular formula C30H26O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,2,4-triphenylbutane-1,4-dione.
| Compound Name | 2-(4-ethylphenyl)-1,2,4-triphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 167435265 |
| Molecular Formula | C30H26O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(4-ethylphenyl)-1,2,4-triphenylbutane-1,4-dione |
| SMILES | CCc1ccc(C(CC(=O)c2ccccc2)(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26O2/c1-2-23-18-20-27(21-19-23)30(26-16-10-5-11-17-26,29(32)25-14-8-4-9-15-25)22-28(31)24-12-6-3-7-13-24/h3-21H,2,22H2,1H3 |
| InChIKey | UVSOTHZNNKVIPM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |