C34H26O3 — CID 167435267
2-(4-phenoxyphenyl)-1,2,4-triphenylbutane-1,4-dione (PubChem CID 167435267) has the molecular formula C34H26O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-(4-phenoxyphenyl)-1,2,4-triphenylbutane-1,4-dione.
| Compound Name | 2-(4-phenoxyphenyl)-1,2,4-triphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 167435267 |
| Molecular Formula | C34H26O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-(4-phenoxyphenyl)-1,2,4-triphenylbutane-1,4-dione |
| SMILES | O=C(CC(C(=O)c1ccccc1)(c1ccccc1)c1ccc(Oc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H26O3/c35-32(26-13-5-1-6-14-26)25-34(28-17-9-3-10-18-28,33(36)27-15-7-2-8-16-27)29-21-23-31(24-22-29)37-30-19-11-4-12-20-30/h1-24H,25H2 |
| InChIKey | XOVRLSSUJOWYDA-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |