C19H22O5 — CID 19797930
methyl 2,2-diethoxy-2-(4-phenoxyphenyl)acetate (PubChem CID 19797930) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl 2,2-diethoxy-2-(4-phenoxyphenyl)acetate.
| Compound Name | methyl 2,2-diethoxy-2-(4-phenoxyphenyl)acetate |
|---|---|
| PubChem CID | 19797930 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | methyl 2,2-diethoxy-2-(4-phenoxyphenyl)acetate |
| SMILES | CCOC(OCC)(C(=O)OC)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O5/c1-4-22-19(23-5-2,18(20)21-3)15-11-13-17(14-12-15)24-16-9-7-6-8-10-16/h6-14H,4-5H2,1-3H3 |
| InChIKey | YULJZPYBDPYWSI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|