About chlorobenzene;2-chloro-1-phenylethanone
chlorobenzene;2-chloro-1-phenylethanone (PubChem CID 21408930) has the molecular formula C14H12Cl2O
and a molecular weight of 267.15 g/mol. Its IUPAC name is chlorobenzene;2-chloro-1-phenylethanone.
Molecular Properties
| Compound Name | chlorobenzene;2-chloro-1-phenylethanone |
| PubChem CID | 21408930 |
| Molecular Formula | C14H12Cl2O |
| Molecular Weight | 267.15 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | chlorobenzene;2-chloro-1-phenylethanone |
| SMILES | Clc1ccccc1.O=C(CCl)c1ccccc1 |
| InChI | InChI=1S/C8H7ClO.C6H5Cl/c9-6-8(10)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5H,6H2;1-5H |
| InChIKey | TXVGPZCZLIRRAN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.15 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;2-chloro-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;2-chloro-1-phenylethanone?
The IUPAC name of chlorobenzene;2-chloro-1-phenylethanone (CID 21408930) is chlorobenzene;2-chloro-1-phenylethanone.
What is the SMILES notation for chlorobenzene;2-chloro-1-phenylethanone?
The canonical SMILES for chlorobenzene;2-chloro-1-phenylethanone is Clc1ccccc1.O=C(CCl)c1ccccc1.
What is the InChIKey of chlorobenzene;2-chloro-1-phenylethanone?
The InChIKey is TXVGPZCZLIRRAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO.C6H5Cl/c9-6-8(10)7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5H,6H2;1-5H.
What are the key properties of chlorobenzene;2-chloro-1-phenylethanone?
chlorobenzene;2-chloro-1-phenylethanone has a molecular weight of 267.15 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;2-chloro-1-phenylethanone is sourced from PubChem (CID 21408930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).