C14H10ClFO — CID 21408998
2-chloro-1-phenylethanone;6-fluorobicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 21408998) has the molecular formula C14H10ClFO and a molecular weight of 248.68 g/mol. Its IUPAC name is 2-chloro-1-phenylethanone;6-fluorobicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | 2-chloro-1-phenylethanone;6-fluorobicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 21408998 |
| Molecular Formula | C14H10ClFO |
| Molecular Weight | 248.68 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-chloro-1-phenylethanone;6-fluorobicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | Fc1c2cccc1-2.O=C(CCl)c1ccccc1 |
| InChI | InChI=1S/C8H7ClO.C6H3F/c9-6-8(10)7-4-2-1-3-5-7;7-6-4-2-1-3-5(4)6/h1-5H,6H2;1-3H |
| InChIKey | OGOATCQIIOXATG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|