About 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene
2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene (PubChem CID 174473009) has the molecular formula C14H13Cl2NO
and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene.
Molecular Properties
| Compound Name | 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene |
| PubChem CID | 174473009 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene |
| SMILES | Clc1ccccc1.NCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8ClNO.C6H5Cl/c9-7-3-1-6(2-4-7)8(11)5-10;7-6-4-2-1-3-5-6/h1-4H,5,10H2;1-5H |
| InChIKey | GYVMSJAMMKTXIU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene?
The IUPAC name of 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene (CID 174473009) is 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene.
What is the SMILES notation for 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene?
The canonical SMILES for 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene is Clc1ccccc1.NCC(=O)c1ccc(Cl)cc1.
What is the InChIKey of 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene?
The InChIKey is GYVMSJAMMKTXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO.C6H5Cl/c9-7-3-1-6(2-4-7)8(11)5-10;7-6-4-2-1-3-5-6/h1-4H,5,10H2;1-5H.
What are the key properties of 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene?
2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene has a molecular weight of 282.17 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(4-chlorophenyl)ethanone;chlorobenzene is sourced from PubChem (CID 174473009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).