C17H16Cl2FNO2 — CID 57226302
3,3-bis(4-chlorophenyl)-2-fluoro-2-(hydroxymethyl)butanamide (PubChem CID 57226302) has the molecular formula C17H16Cl2FNO2 and a molecular weight of 356.22 g/mol. Its IUPAC name is 3,3-bis(4-chlorophenyl)-2-fluoro-2-(hydroxymethyl)butanamide.
| Compound Name | 3,3-bis(4-chlorophenyl)-2-fluoro-2-(hydroxymethyl)butanamide |
|---|---|
| PubChem CID | 57226302 |
| Molecular Formula | C17H16Cl2FNO2 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3,3-bis(4-chlorophenyl)-2-fluoro-2-(hydroxymethyl)butanamide |
| SMILES | CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(F)(CO)C(N)=O |
| InChI | InChI=1S/C17H16Cl2FNO2/c1-16(17(20,10-22)15(21)23,11-2-6-13(18)7-3-11)12-4-8-14(19)9-5-12/h2-9,22H,10H2,1H3,(H2,21,23) |
| InChIKey | ZXYZSTPRCZUYMD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |