About bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel
bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel (PubChem CID 155859224) has the molecular formula C32H34N2NiS4
and a molecular weight of 633.60 g/mol. Its IUPAC name is bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel.
Molecular Properties
| Compound Name | bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel |
| PubChem CID | 155859224 |
| Molecular Formula | C32H34N2NiS4 |
| Molecular Weight | 633.60 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel |
| SMILES | CN(C)c1ccc(/C(S)=C(/S)c2ccccc2)cc1.CN(C)c1ccc(/C(S)=C(/S)c2ccccc2)cc1.[Ni] |
| InChI | InChI=1S/2C16H17NS2.Ni/c2*1-17(2)14-10-8-13(9-11-14)16(19)15(18)12-6-4-3-5-7-12;/h2*3-11,18-19H,1-2H3;/b2*16-15-; |
| InChIKey | LDYCDKFAGIOUDE-JZONXAMZSA-N |
| XLogP | 8.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 633.60 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel?
The IUPAC name of bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel (CID 155859224) is bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel.
What is the SMILES notation for bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel?
The canonical SMILES for bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel is CN(C)c1ccc(/C(S)=C(/S)c2ccccc2)cc1.CN(C)c1ccc(/C(S)=C(/S)c2ccccc2)cc1.[Ni].
What is the InChIKey of bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel?
The InChIKey is LDYCDKFAGIOUDE-JZONXAMZSA-N. The full InChI is InChI=1S/2C16H17NS2.Ni/c2*1-17(2)14-10-8-13(9-11-14)16(19)15(18)12-6-4-3-5-7-12;/h2*3-11,18-19H,1-2H3;/b2*16-15-;.
What are the key properties of bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel?
bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel has a molecular weight of 633.60 g/mol, XLogP of 8.87, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-1-[4-(dimethylamino)phenyl]-2-phenylethene-1,2-dithiol);nickel is sourced from PubChem (CID 155859224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).