C18H22N2S2 — CID 72743774
1,2-bis[4-(dimethylamino)phenyl]ethene-1,2-dithiol (PubChem CID 72743774) has the molecular formula C18H22N2S2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 1,2-bis[4-(dimethylamino)phenyl]ethene-1,2-dithiol.
| Compound Name | 1,2-bis[4-(dimethylamino)phenyl]ethene-1,2-dithiol |
|---|---|
| PubChem CID | 72743774 |
| Molecular Formula | C18H22N2S2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1,2-bis[4-(dimethylamino)phenyl]ethene-1,2-dithiol |
| SMILES | CN(C)c1ccc(C(S)=C(S)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H22N2S2/c1-19(2)15-9-5-13(6-10-15)17(21)18(22)14-7-11-16(12-8-14)20(3)4/h5-12,21-22H,1-4H3 |
| InChIKey | INNMWOVVUPSCHL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|