C18H32N2O5 — CID 174923896
2-[bis(2-hydroxypropan-2-yl)amino]propan-2-ol;4-(dimethylamino)benzoic acid (PubChem CID 174923896) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-[bis(2-hydroxypropan-2-yl)amino]propan-2-ol;4-(dimethylamino)benzoic acid.
| Compound Name | 2-[bis(2-hydroxypropan-2-yl)amino]propan-2-ol;4-(dimethylamino)benzoic acid |
|---|---|
| PubChem CID | 174923896 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 2-[bis(2-hydroxypropan-2-yl)amino]propan-2-ol;4-(dimethylamino)benzoic acid |
| SMILES | CC(C)(O)N(C(C)(C)O)C(C)(C)O.CN(C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H21NO3.C9H11NO2/c1-7(2,11)10(8(3,4)12)9(5,6)13;1-10(2)8-5-3-7(4-6-8)9(11)12/h11-13H,1-6H3;3-6H,1-2H3,(H,11,12) |
| InChIKey | LJRQTMBFPNKMEW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|