About 4-(dimethylamino)benzoic acid;ethanamine
4-(dimethylamino)benzoic acid;ethanamine (PubChem CID 159433676) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(dimethylamino)benzoic acid;ethanamine.
Molecular Properties
| Compound Name | 4-(dimethylamino)benzoic acid;ethanamine |
| PubChem CID | 159433676 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-(dimethylamino)benzoic acid;ethanamine |
| SMILES | CCN.CN(C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H11NO2.C2H7N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6H,1-2H3,(H,11,12);2-3H2,1H3 |
| InChIKey | LRHMDMFHLJYUBW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(dimethylamino)benzoic acid;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)benzoic acid;ethanamine?
The IUPAC name of 4-(dimethylamino)benzoic acid;ethanamine (CID 159433676) is 4-(dimethylamino)benzoic acid;ethanamine.
What is the SMILES notation for 4-(dimethylamino)benzoic acid;ethanamine?
The canonical SMILES for 4-(dimethylamino)benzoic acid;ethanamine is CCN.CN(C)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(dimethylamino)benzoic acid;ethanamine?
The InChIKey is LRHMDMFHLJYUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C2H7N/c1-10(2)8-5-3-7(4-6-8)9(11)12;1-2-3/h3-6H,1-2H3,(H,11,12);2-3H2,1H3.
What are the key properties of 4-(dimethylamino)benzoic acid;ethanamine?
4-(dimethylamino)benzoic acid;ethanamine has a molecular weight of 210.28 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)benzoic acid;ethanamine is sourced from PubChem (CID 159433676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).