About 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol
4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol (PubChem CID 144503984) has the molecular formula C15H20N4O2S
and a molecular weight of 320.42 g/mol. Its IUPAC name is 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol.
Molecular Properties
| Compound Name | 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol |
| PubChem CID | 144503984 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol |
| SMILES | CCS.NN(c1ccccc1)N(N)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H14N4O2.C2H6S/c14-16(11-4-2-1-3-5-11)17(15)12-8-6-10(7-9-12)13(18)19;1-2-3/h1-9H,14-15H2,(H,18,19);3H,2H2,1H3 |
| InChIKey | UMYVBXFAOSZXQA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol?
The IUPAC name of 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol (CID 144503984) is 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol.
What is the SMILES notation for 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol?
The canonical SMILES for 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol is CCS.NN(c1ccccc1)N(N)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol?
The InChIKey is UMYVBXFAOSZXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2.C2H6S/c14-16(11-4-2-1-3-5-11)17(15)12-8-6-10(7-9-12)13(18)19;1-2-3/h1-9H,14-15H2,(H,18,19);3H,2H2,1H3.
What are the key properties of 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol?
4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol has a molecular weight of 320.42 g/mol, XLogP of 2.30, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[amino-(N-aminoanilino)amino]benzoic acid;ethanethiol is sourced from PubChem (CID 144503984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).